C22H29FN6O2 — CID 66890408
3-[[5-fluoro-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]cyclopentane-1-carboxylic acid (PubChem CID 66890408) has the molecular formula C22H29FN6O2 and a molecular weight of 428.51 g/mol. Its IUPAC name is 3-[[5-fluoro-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]cyclopentane-1-carboxylic acid.
| Compound Name | 3-[[5-fluoro-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 66890408 |
| Molecular Formula | C22H29FN6O2 |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 3-[[5-fluoro-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]cyclopentane-1-carboxylic acid |
| SMILES | Cc1cc(Nc2ncc(F)c(NC3CCC(C(=O)O)C3)n2)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C22H29FN6O2/c1-14-11-16(5-6-19(14)29-9-7-28(2)8-10-29)26-22-24-13-18(23)20(27-22)25-17-4-3-15(12-17)21(30)31/h5-6,11,13,15,17H,3-4,7-10,12H2,1-2H3,(H,30,31)(H2,24,25,26,27) |
| InChIKey | JRXMVBTZJXHWNX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|