C34H44FN7O2 — CID 89472516
(1R,2R,5S,6S)-6-[[5-fluoro-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-N-[(1R)-1-(4-methoxyphenyl)ethyl]-2,5-dimethylcyclohex-3-ene-1-carboxamide (PubChem CID 89472516) has the molecular formula C34H44FN7O2 and a molecular weight of 601.77 g/mol. Its IUPAC name is (1R,2R,5S,6S)-6-[[5-fluoro-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-N-[(1R)-1-(4-methoxyphenyl)ethyl]-2,5-dimethylcyclohex-3-ene-1-carboxamide.
| Compound Name | (1R,2R,5S,6S)-6-[[5-fluoro-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-N-[(1R)-1-(4-methoxyphenyl)ethyl]-2,5-dimethylcyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 89472516 |
| Molecular Formula | C34H44FN7O2 |
| Molecular Weight | 601.77 g/mol |
| Exact Mass | 601.35 |
| IUPAC Name | (1R,2R,5S,6S)-6-[[5-fluoro-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-N-[(1R)-1-(4-methoxyphenyl)ethyl]-2,5-dimethylcyclohex-3-ene-1-carboxamide |
| SMILES | COc1ccc([C@@H](C)NC(=O)[C@H]2[C@@H](Nc3nc(Nc4ccc(N5CCN(C)CC5)c(C)c4)ncc3F)[C@@H](C)C=C[C@H]2C)cc1 |
| InChI | InChI=1S/C34H44FN7O2/c1-21-7-8-22(2)31(30(21)33(43)37-24(4)25-9-12-27(44-6)13-10-25)39-32-28(35)20-36-34(40-32)38-26-11-14-29(23(3)19-26)42-17-15-41(5)16-18-42/h7-14,19-22,24,30-31H,15-18H2,1-6H3,(H,37,43)(H2,36,38,39,40)/t21-,22+,24-,30-,31+/m1/s1 |
| InChIKey | ZFUPCHYUMXVHRT-NCNKDLMASA-N |
| XLogP | 5.54 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.77 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|