C27H34FN7O — CID 59381781
N-cyclopropyl-3-[[5-fluoro-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 59381781) has the molecular formula C27H34FN7O and a molecular weight of 491.62 g/mol. Its IUPAC name is N-cyclopropyl-3-[[5-fluoro-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | N-cyclopropyl-3-[[5-fluoro-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 59381781 |
| Molecular Formula | C27H34FN7O |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | N-cyclopropyl-3-[[5-fluoro-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | Cc1cc(Nc2ncc(F)c(NC3C4C=CC(C4)C3C(=O)NC3CC3)n2)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C27H34FN7O/c1-16-13-20(7-8-22(16)35-11-9-34(2)10-12-35)31-27-29-15-21(28)25(33-27)32-24-18-4-3-17(14-18)23(24)26(36)30-19-5-6-19/h3-4,7-8,13,15,17-19,23-24H,5-6,9-12,14H2,1-2H3,(H,30,36)(H2,29,31,32,33) |
| InChIKey | QAGGVCWYFWHDDW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|