C23H28FN7O — CID 59381734
3-[[5-fluoro-2-[3-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 59381734) has the molecular formula C23H28FN7O and a molecular weight of 437.52 g/mol. Its IUPAC name is 3-[[5-fluoro-2-[3-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | 3-[[5-fluoro-2-[3-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 59381734 |
| Molecular Formula | C23H28FN7O |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 3-[[5-fluoro-2-[3-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | CN1CCN(c2cccc(Nc3ncc(F)c(NC4C5C=CC(C5)C4C(N)=O)n3)c2)CC1 |
| InChI | InChI=1S/C23H28FN7O/c1-30-7-9-31(10-8-30)17-4-2-3-16(12-17)27-23-26-13-18(24)22(29-23)28-20-15-6-5-14(11-15)19(20)21(25)32/h2-6,12-15,19-20H,7-11H2,1H3,(H2,25,32)(H2,26,27,28,29) |
| InChIKey | HTPHLJNINAMSPS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|