C24H29FN6O — CID 59381722
3-[[5-fluoro-2-[3-(1-methylpiperidin-4-yl)anilino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 59381722) has the molecular formula C24H29FN6O and a molecular weight of 436.54 g/mol. Its IUPAC name is 3-[[5-fluoro-2-[3-(1-methylpiperidin-4-yl)anilino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | 3-[[5-fluoro-2-[3-(1-methylpiperidin-4-yl)anilino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 59381722 |
| Molecular Formula | C24H29FN6O |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 3-[[5-fluoro-2-[3-(1-methylpiperidin-4-yl)anilino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | CN1CCC(c2cccc(Nc3ncc(F)c(NC4C5C=CC(C5)C4C(N)=O)n3)c2)CC1 |
| InChI | InChI=1S/C24H29FN6O/c1-31-9-7-14(8-10-31)15-3-2-4-18(12-15)28-24-27-13-19(25)23(30-24)29-21-17-6-5-16(11-17)20(21)22(26)32/h2-6,12-14,16-17,20-21H,7-11H2,1H3,(H2,26,32)(H2,27,28,29,30) |
| InChIKey | NTJLAEBEKKEESF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|