C21H24FN5O4 — CID 68687621
(3R,4R)-3-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 68687621) has the molecular formula C21H24FN5O4 and a molecular weight of 429.45 g/mol. Its IUPAC name is (3R,4R)-3-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (3R,4R)-3-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 68687621 |
| Molecular Formula | C21H24FN5O4 |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | (3R,4R)-3-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | COc1cc(Nc2ncc(F)c(N[C@H]3C(C(N)=O)C4C=C[C@H]3C4)n2)cc(OC)c1OC |
| InChI | InChI=1S/C21H24FN5O4/c1-29-14-7-12(8-15(30-2)18(14)31-3)25-21-24-9-13(22)20(27-21)26-17-11-5-4-10(6-11)16(17)19(23)28/h4-5,7-11,16-17H,6H2,1-3H3,(H2,23,28)(H2,24,25,26,27)/t10?,11-,16?,17+/m0/s1 |
| InChIKey | DWHHDWIAGDEYHK-CXTBWJHYSA-N |
| XLogP | 2.47 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|