C25H27FN8O2 — CID 25073183
5-[[4-[4-(cyanomethoxy)anilino]-5-fluoropyrimidin-2-yl]amino]-N-methyl-2-(4-methylpiperazin-1-yl)benzamide (PubChem CID 25073183) has the molecular formula C25H27FN8O2 and a molecular weight of 490.54 g/mol. Its IUPAC name is 5-[[4-[4-(cyanomethoxy)anilino]-5-fluoropyrimidin-2-yl]amino]-N-methyl-2-(4-methylpiperazin-1-yl)benzamide.
| Compound Name | 5-[[4-[4-(cyanomethoxy)anilino]-5-fluoropyrimidin-2-yl]amino]-N-methyl-2-(4-methylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 25073183 |
| Molecular Formula | C25H27FN8O2 |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 5-[[4-[4-(cyanomethoxy)anilino]-5-fluoropyrimidin-2-yl]amino]-N-methyl-2-(4-methylpiperazin-1-yl)benzamide |
| SMILES | CNC(=O)c1cc(Nc2ncc(F)c(Nc3ccc(OCC#N)cc3)n2)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C25H27FN8O2/c1-28-24(35)20-15-18(5-8-22(20)34-12-10-33(2)11-13-34)31-25-29-16-21(26)23(32-25)30-17-3-6-19(7-4-17)36-14-9-27/h3-8,15-16H,10-14H2,1-2H3,(H,28,35)(H2,29,30,31,32) |
| InChIKey | ZKKICTNOBAJHMN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|