C19H14ClFN6O2 — CID 15951658
4-[[4-[3-chloro-4-(cyanomethoxy)anilino]-5-fluoropyrimidin-2-yl]amino]benzamide (PubChem CID 15951658) has the molecular formula C19H14ClFN6O2 and a molecular weight of 412.81 g/mol. Its IUPAC name is 4-[[4-[3-chloro-4-(cyanomethoxy)anilino]-5-fluoropyrimidin-2-yl]amino]benzamide.
| Compound Name | 4-[[4-[3-chloro-4-(cyanomethoxy)anilino]-5-fluoropyrimidin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 15951658 |
| Molecular Formula | C19H14ClFN6O2 |
| Molecular Weight | 412.81 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 4-[[4-[3-chloro-4-(cyanomethoxy)anilino]-5-fluoropyrimidin-2-yl]amino]benzamide |
| SMILES | N#CCOc1ccc(Nc2nc(Nc3ccc(C(N)=O)cc3)ncc2F)cc1Cl |
| InChI | InChI=1S/C19H14ClFN6O2/c20-14-9-13(5-6-16(14)29-8-7-22)25-18-15(21)10-24-19(27-18)26-12-3-1-11(2-4-12)17(23)28/h1-6,9-10H,8H2,(H2,23,28)(H2,24,25,26,27) |
| InChIKey | JDNJOMWHEGYGLU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.81 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |