C19H17ClFN5O2 — CID 142899072
N-[2-chloro-4-[[5-fluoro-4-(3-methoxyanilino)pyrimidin-2-yl]amino]phenyl]acetamide (PubChem CID 142899072) has the molecular formula C19H17ClFN5O2 and a molecular weight of 401.83 g/mol. Its IUPAC name is N-[2-chloro-4-[[5-fluoro-4-(3-methoxyanilino)pyrimidin-2-yl]amino]phenyl]acetamide.
| Compound Name | N-[2-chloro-4-[[5-fluoro-4-(3-methoxyanilino)pyrimidin-2-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 142899072 |
| Molecular Formula | C19H17ClFN5O2 |
| Molecular Weight | 401.83 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | N-[2-chloro-4-[[5-fluoro-4-(3-methoxyanilino)pyrimidin-2-yl]amino]phenyl]acetamide |
| SMILES | COc1cccc(Nc2nc(Nc3ccc(NC(C)=O)c(Cl)c3)ncc2F)c1 |
| InChI | InChI=1S/C19H17ClFN5O2/c1-11(27)23-17-7-6-13(9-15(17)20)25-19-22-10-16(21)18(26-19)24-12-4-3-5-14(8-12)28-2/h3-10H,1-2H3,(H,23,27)(H2,22,24,25,26) |
| InChIKey | LQLZYKNTSDQLJH-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.83 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |