C19H15ClF3N5O — CID 164619885
N-[4-[[5-chloro-4-[3-(trifluoromethyl)anilino]pyrimidin-2-yl]amino]phenyl]acetamide (PubChem CID 164619885) has the molecular formula C19H15ClF3N5O and a molecular weight of 421.81 g/mol. Its IUPAC name is N-[4-[[5-chloro-4-[3-(trifluoromethyl)anilino]pyrimidin-2-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[5-chloro-4-[3-(trifluoromethyl)anilino]pyrimidin-2-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 164619885 |
| Molecular Formula | C19H15ClF3N5O |
| Molecular Weight | 421.81 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | N-[4-[[5-chloro-4-[3-(trifluoromethyl)anilino]pyrimidin-2-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2ncc(Cl)c(Nc3cccc(C(F)(F)F)c3)n2)cc1 |
| InChI | InChI=1S/C19H15ClF3N5O/c1-11(29)25-13-5-7-14(8-6-13)27-18-24-10-16(20)17(28-18)26-15-4-2-3-12(9-15)19(21,22)23/h2-10H,1H3,(H,25,29)(H2,24,26,27,28) |
| InChIKey | TZOZVGDATPYOJO-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.81 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |