C24H20ClN5O — CID 175186645
N-[3-[(4-anilino-5-chloropyrimidin-2-yl)amino]phenyl]-2-methylbenzamide (PubChem CID 175186645) has the molecular formula C24H20ClN5O and a molecular weight of 429.91 g/mol. Its IUPAC name is N-[3-[(4-anilino-5-chloropyrimidin-2-yl)amino]phenyl]-2-methylbenzamide.
| Compound Name | N-[3-[(4-anilino-5-chloropyrimidin-2-yl)amino]phenyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 175186645 |
| Molecular Formula | C24H20ClN5O |
| Molecular Weight | 429.91 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | N-[3-[(4-anilino-5-chloropyrimidin-2-yl)amino]phenyl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)Nc1cccc(Nc2ncc(Cl)c(Nc3ccccc3)n2)c1 |
| InChI | InChI=1S/C24H20ClN5O/c1-16-8-5-6-13-20(16)23(31)28-18-11-7-12-19(14-18)29-24-26-15-21(25)22(30-24)27-17-9-3-2-4-10-17/h2-15H,1H3,(H,28,31)(H2,26,27,29,30) |
| InChIKey | LAPIVBZNIDLGKY-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.91 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |