C21H19N5O2 — CID 71556767
2-methyl-N-[2-[3-(prop-2-enoylamino)anilino]pyrimidin-5-yl]benzamide (PubChem CID 71556767) has the molecular formula C21H19N5O2 and a molecular weight of 373.42 g/mol. Its IUPAC name is 2-methyl-N-[2-[3-(prop-2-enoylamino)anilino]pyrimidin-5-yl]benzamide.
| Compound Name | 2-methyl-N-[2-[3-(prop-2-enoylamino)anilino]pyrimidin-5-yl]benzamide |
|---|---|
| PubChem CID | 71556767 |
| Molecular Formula | C21H19N5O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 2-methyl-N-[2-[3-(prop-2-enoylamino)anilino]pyrimidin-5-yl]benzamide |
| SMILES | C=CC(=O)Nc1cccc(Nc2ncc(NC(=O)c3ccccc3C)cn2)c1 |
| InChI | InChI=1S/C21H19N5O2/c1-3-19(27)24-15-8-6-9-16(11-15)26-21-22-12-17(13-23-21)25-20(28)18-10-5-4-7-14(18)2/h3-13H,1H2,2H3,(H,24,27)(H,25,28)(H,22,23,26) |
| InChIKey | HPJHXWTXYIRRBU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|