C23H21Cl2N5O4 — CID 134457615
2,6-dichloro-3,5-dimethoxy-N-[2-[2-methyl-6-(prop-2-enoylamino)anilino]pyrimidin-5-yl]benzamide (PubChem CID 134457615) has the molecular formula C23H21Cl2N5O4 and a molecular weight of 502.36 g/mol. Its IUPAC name is 2,6-dichloro-3,5-dimethoxy-N-[2-[2-methyl-6-(prop-2-enoylamino)anilino]pyrimidin-5-yl]benzamide.
| Compound Name | 2,6-dichloro-3,5-dimethoxy-N-[2-[2-methyl-6-(prop-2-enoylamino)anilino]pyrimidin-5-yl]benzamide |
|---|---|
| PubChem CID | 134457615 |
| Molecular Formula | C23H21Cl2N5O4 |
| Molecular Weight | 502.36 g/mol |
| Exact Mass | 501.10 |
| IUPAC Name | 2,6-dichloro-3,5-dimethoxy-N-[2-[2-methyl-6-(prop-2-enoylamino)anilino]pyrimidin-5-yl]benzamide |
| SMILES | C=CC(=O)Nc1cccc(C)c1Nc1ncc(NC(=O)c2c(Cl)c(OC)cc(OC)c2Cl)cn1 |
| InChI | InChI=1S/C23H21Cl2N5O4/c1-5-17(31)29-14-8-6-7-12(2)21(14)30-23-26-10-13(11-27-23)28-22(32)18-19(24)15(33-3)9-16(34-4)20(18)25/h5-11H,1H2,2-4H3,(H,28,32)(H,29,31)(H,26,27,30) |
| InChIKey | JRUKYSSMJXAPEH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.36 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|