C23H28N6O2 — CID 175900591
N-[2-[[8-(2,2-dimethylpropylamino)-6-methylpyrido[3,4-d]pyrimidin-2-yl]amino]-3-methoxyphenyl]prop-2-enamide (PubChem CID 175900591) has the molecular formula C23H28N6O2 and a molecular weight of 420.52 g/mol. Its IUPAC name is N-[2-[[8-(2,2-dimethylpropylamino)-6-methylpyrido[3,4-d]pyrimidin-2-yl]amino]-3-methoxyphenyl]prop-2-enamide.
| Compound Name | N-[2-[[8-(2,2-dimethylpropylamino)-6-methylpyrido[3,4-d]pyrimidin-2-yl]amino]-3-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 175900591 |
| Molecular Formula | C23H28N6O2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | N-[2-[[8-(2,2-dimethylpropylamino)-6-methylpyrido[3,4-d]pyrimidin-2-yl]amino]-3-methoxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(OC)c1Nc1ncc2cc(C)nc(NCC(C)(C)C)c2n1 |
| InChI | InChI=1S/C23H28N6O2/c1-7-18(30)27-16-9-8-10-17(31-6)20(16)29-22-24-12-15-11-14(2)26-21(19(15)28-22)25-13-23(3,4)5/h7-12H,1,13H2,2-6H3,(H,25,26)(H,27,30)(H,24,28,29) |
| InChIKey | ONOXXDDSWYVKJI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|