C27H23Cl2F3N6O3 — CID 135181077
N-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-(2,2,2-trifluoroethylamino)pyrido[3,4-d]pyrimidin-2-yl]amino]-3-methylphenyl]prop-2-enamide (PubChem CID 135181077) has the molecular formula C27H23Cl2F3N6O3 and a molecular weight of 607.42 g/mol. Its IUPAC name is N-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-(2,2,2-trifluoroethylamino)pyrido[3,4-d]pyrimidin-2-yl]amino]-3-methylphenyl]prop-2-enamide.
| Compound Name | N-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-(2,2,2-trifluoroethylamino)pyrido[3,4-d]pyrimidin-2-yl]amino]-3-methylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 135181077 |
| Molecular Formula | C27H23Cl2F3N6O3 |
| Molecular Weight | 607.42 g/mol |
| Exact Mass | 606.12 |
| IUPAC Name | N-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-(2,2,2-trifluoroethylamino)pyrido[3,4-d]pyrimidin-2-yl]amino]-3-methylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(C)c1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)nc(NCC(F)(F)F)c2n1 |
| InChI | InChI=1S/C27H23Cl2F3N6O3/c1-5-19(39)35-15-8-6-7-13(2)23(15)37-26-33-11-14-9-16(36-25(24(14)38-26)34-12-27(30,31)32)20-21(28)17(40-3)10-18(41-4)22(20)29/h5-11H,1,12H2,2-4H3,(H,34,36)(H,35,39)(H,33,37,38) |
| InChIKey | JJESFFIVRGCPQO-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.42 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|