C29H30Cl2N6O3S — CID 139395556
N-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-(2-ethylsulfanylethylamino)pyrido[3,4-d]pyrimidin-2-yl]amino]-3-methylphenyl]prop-2-enamide (PubChem CID 139395556) has the molecular formula C29H30Cl2N6O3S and a molecular weight of 613.57 g/mol. Its IUPAC name is N-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-(2-ethylsulfanylethylamino)pyrido[3,4-d]pyrimidin-2-yl]amino]-3-methylphenyl]prop-2-enamide.
| Compound Name | N-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-(2-ethylsulfanylethylamino)pyrido[3,4-d]pyrimidin-2-yl]amino]-3-methylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 139395556 |
| Molecular Formula | C29H30Cl2N6O3S |
| Molecular Weight | 613.57 g/mol |
| Exact Mass | 612.15 |
| IUPAC Name | N-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-(2-ethylsulfanylethylamino)pyrido[3,4-d]pyrimidin-2-yl]amino]-3-methylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(C)c1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)nc(NCCSCC)c2n1 |
| InChI | InChI=1S/C29H30Cl2N6O3S/c1-6-22(38)34-18-10-8-9-16(3)26(18)36-29-33-15-17-13-19(35-28(27(17)37-29)32-11-12-41-7-2)23-24(30)20(39-4)14-21(40-5)25(23)31/h6,8-10,13-15H,1,7,11-12H2,2-5H3,(H,32,35)(H,34,38)(H,33,36,37) |
| InChIKey | AIJDROFGTGLNEB-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.57 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|