C28H26Cl2N4O4 — CID 161436783
1-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-ethoxypyrido[3,4-d]pyrimidin-2-yl]amino]-3-methylphenyl]but-3-en-2-one (PubChem CID 161436783) has the molecular formula C28H26Cl2N4O4 and a molecular weight of 553.45 g/mol. Its IUPAC name is 1-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-ethoxypyrido[3,4-d]pyrimidin-2-yl]amino]-3-methylphenyl]but-3-en-2-one.
| Compound Name | 1-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-ethoxypyrido[3,4-d]pyrimidin-2-yl]amino]-3-methylphenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 161436783 |
| Molecular Formula | C28H26Cl2N4O4 |
| Molecular Weight | 553.45 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | 1-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-ethoxypyrido[3,4-d]pyrimidin-2-yl]amino]-3-methylphenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cccc(C)c1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)nc(OCC)c2n1 |
| InChI | InChI=1S/C28H26Cl2N4O4/c1-6-18(35)11-16-10-8-9-15(3)25(16)33-28-31-14-17-12-19(32-27(38-7-2)26(17)34-28)22-23(29)20(36-4)13-21(37-5)24(22)30/h6,8-10,12-14H,1,7,11H2,2-5H3,(H,31,33,34) |
| InChIKey | VYTCNPWJPUTCCX-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.45 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|