C25H29N5O4 — CID 159775292
N-[3-[[5-acetyl-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide;methane (PubChem CID 159775292) has the molecular formula C25H29N5O4 and a molecular weight of 463.54 g/mol. Its IUPAC name is N-[3-[[5-acetyl-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide;methane.
| Compound Name | N-[3-[[5-acetyl-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide;methane |
|---|---|
| PubChem CID | 159775292 |
| Molecular Formula | C25H29N5O4 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | N-[3-[[5-acetyl-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide;methane |
| SMILES | C.C=CC(=O)Nc1cccc(Nc2nc(Nc3ccc(OCCOC)cc3)ncc2C(C)=O)c1 |
| InChI | InChI=1S/C24H25N5O4.CH4/c1-4-22(31)26-18-6-5-7-19(14-18)27-23-21(16(2)30)15-25-24(29-23)28-17-8-10-20(11-9-17)33-13-12-32-3;/h4-11,14-15H,1,12-13H2,2-3H3,(H,26,31)(H2,25,27,28,29);1H4 |
| InChIKey | NGQRKAQBATWDKX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|