C23H21FN6O3 — CID 59174798
N-[3-[[2-[3-fluoro-4-(2-methoxyethoxy)anilino]-5-isocyanopyrimidin-4-yl]amino]phenyl]prop-2-enamide (PubChem CID 59174798) has the molecular formula C23H21FN6O3 and a molecular weight of 448.46 g/mol. Its IUPAC name is N-[3-[[2-[3-fluoro-4-(2-methoxyethoxy)anilino]-5-isocyanopyrimidin-4-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[2-[3-fluoro-4-(2-methoxyethoxy)anilino]-5-isocyanopyrimidin-4-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 59174798 |
| Molecular Formula | C23H21FN6O3 |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | N-[3-[[2-[3-fluoro-4-(2-methoxyethoxy)anilino]-5-isocyanopyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| SMILES | [C-]#[N+]c1cnc(Nc2ccc(OCCOC)c(F)c2)nc1Nc1cccc(NC(=O)C=C)c1 |
| InChI | InChI=1S/C23H21FN6O3/c1-4-21(31)27-15-6-5-7-16(12-15)28-22-19(25-2)14-26-23(30-22)29-17-8-9-20(18(24)13-17)33-11-10-32-3/h4-9,12-14H,1,10-11H2,3H3,(H,27,31)(H2,26,28,29,30) |
| InChIKey | IVCFXOFPPPOGTD-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 101.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|