C27H29F2N5O4 — CID 89432675
[(2R)-2-[2-fluoro-4-[[5-fluoro-4-[3-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]phenoxy]propyl] 3-methylbutanoate (PubChem CID 89432675) has the molecular formula C27H29F2N5O4 and a molecular weight of 525.56 g/mol. Its IUPAC name is [(2R)-2-[2-fluoro-4-[[5-fluoro-4-[3-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]phenoxy]propyl] 3-methylbutanoate.
| Compound Name | [(2R)-2-[2-fluoro-4-[[5-fluoro-4-[3-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]phenoxy]propyl] 3-methylbutanoate |
|---|---|
| PubChem CID | 89432675 |
| Molecular Formula | C27H29F2N5O4 |
| Molecular Weight | 525.56 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | [(2R)-2-[2-fluoro-4-[[5-fluoro-4-[3-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]phenoxy]propyl] 3-methylbutanoate |
| SMILES | C=CC(=O)Nc1cccc(Nc2nc(Nc3ccc(O[C@H](C)COC(=O)CC(C)C)c(F)c3)ncc2F)c1 |
| InChI | InChI=1S/C27H29F2N5O4/c1-5-24(35)31-18-7-6-8-19(12-18)32-26-22(29)14-30-27(34-26)33-20-9-10-23(21(28)13-20)38-17(4)15-37-25(36)11-16(2)3/h5-10,12-14,16-17H,1,11,15H2,2-4H3,(H,31,35)(H2,30,32,33,34)/t17-/m1/s1 |
| InChIKey | JFOAPPRVNBKFHG-QGZVFWFLSA-N |
| XLogP | 5.72 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.56 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|