C26H28F2N6O4 — CID 123985771
2-[2-fluoro-4-[[5-fluoro-4-[3-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]phenoxy]ethyl (2S)-2-amino-3-methylbutanoate (PubChem CID 123985771) has the molecular formula C26H28F2N6O4 and a molecular weight of 526.54 g/mol. Its IUPAC name is 2-[2-fluoro-4-[[5-fluoro-4-[3-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]phenoxy]ethyl (2S)-2-amino-3-methylbutanoate.
| Compound Name | 2-[2-fluoro-4-[[5-fluoro-4-[3-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]phenoxy]ethyl (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 123985771 |
| Molecular Formula | C26H28F2N6O4 |
| Molecular Weight | 526.54 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | 2-[2-fluoro-4-[[5-fluoro-4-[3-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]phenoxy]ethyl (2S)-2-amino-3-methylbutanoate |
| SMILES | C=CC(=O)Nc1cccc(Nc2nc(Nc3ccc(OCCOC(=O)[C@@H](N)C(C)C)c(F)c3)ncc2F)c1 |
| InChI | InChI=1S/C26H28F2N6O4/c1-4-22(35)31-16-6-5-7-17(12-16)32-24-20(28)14-30-26(34-24)33-18-8-9-21(19(27)13-18)37-10-11-38-25(36)23(29)15(2)3/h4-9,12-15,23H,1,10-11,29H2,2-3H3,(H,31,35)(H2,30,32,33,34)/t23-/m0/s1 |
| InChIKey | YPSPUGYYQSCKHP-QHCPKHFHSA-N |
| XLogP | 4.27 |
| TPSA | 140.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|