C21H19ClFN5O3 — CID 143919301
N-[3-[[2-[4-chloro-3-(2-hydroxyethoxy)anilino]-5-fluoropyrimidin-4-yl]amino]phenyl]prop-2-enamide (PubChem CID 143919301) has the molecular formula C21H19ClFN5O3 and a molecular weight of 443.87 g/mol. Its IUPAC name is N-[3-[[2-[4-chloro-3-(2-hydroxyethoxy)anilino]-5-fluoropyrimidin-4-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[2-[4-chloro-3-(2-hydroxyethoxy)anilino]-5-fluoropyrimidin-4-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 143919301 |
| Molecular Formula | C21H19ClFN5O3 |
| Molecular Weight | 443.87 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | N-[3-[[2-[4-chloro-3-(2-hydroxyethoxy)anilino]-5-fluoropyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Nc2nc(Nc3ccc(Cl)c(OCCO)c3)ncc2F)c1 |
| InChI | InChI=1S/C21H19ClFN5O3/c1-2-19(30)25-13-4-3-5-14(10-13)26-20-17(23)12-24-21(28-20)27-15-6-7-16(22)18(11-15)31-9-8-29/h2-7,10-12,29H,1,8-9H2,(H,25,30)(H2,24,26,27,28) |
| InChIKey | RFYNGVOSAGLCSL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 108.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.87 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|