C22H22FN5O3 — CID 90244576
N-[3-[[5-fluoro-2-[4-(2-hydroxyethoxy)anilino]pyrimidin-4-yl]-methylamino]phenyl]prop-2-enamide (PubChem CID 90244576) has the molecular formula C22H22FN5O3 and a molecular weight of 423.45 g/mol. Its IUPAC name is N-[3-[[5-fluoro-2-[4-(2-hydroxyethoxy)anilino]pyrimidin-4-yl]-methylamino]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[5-fluoro-2-[4-(2-hydroxyethoxy)anilino]pyrimidin-4-yl]-methylamino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 90244576 |
| Molecular Formula | C22H22FN5O3 |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | N-[3-[[5-fluoro-2-[4-(2-hydroxyethoxy)anilino]pyrimidin-4-yl]-methylamino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(N(C)c2nc(Nc3ccc(OCCO)cc3)ncc2F)c1 |
| InChI | InChI=1S/C22H22FN5O3/c1-3-20(30)25-16-5-4-6-17(13-16)28(2)21-19(23)14-24-22(27-21)26-15-7-9-18(10-8-15)31-12-11-29/h3-10,13-14,29H,1,11-12H2,2H3,(H,25,30)(H,24,26,27) |
| InChIKey | ODXILZOZURZRHA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|