C27H30FN7O2S2 — CID 155514194
2-[4-[[5-fluoro-4-[3-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]phenoxy]ethyl 4-methylpiperazine-1-carbodithioate (PubChem CID 155514194) has the molecular formula C27H30FN7O2S2 and a molecular weight of 567.72 g/mol. Its IUPAC name is 2-[4-[[5-fluoro-4-[3-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]phenoxy]ethyl 4-methylpiperazine-1-carbodithioate.
| Compound Name | 2-[4-[[5-fluoro-4-[3-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]phenoxy]ethyl 4-methylpiperazine-1-carbodithioate |
|---|---|
| PubChem CID | 155514194 |
| Molecular Formula | C27H30FN7O2S2 |
| Molecular Weight | 567.72 g/mol |
| Exact Mass | 567.19 |
| IUPAC Name | 2-[4-[[5-fluoro-4-[3-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]phenoxy]ethyl 4-methylpiperazine-1-carbodithioate |
| SMILES | C=CC(=O)Nc1cccc(Nc2nc(Nc3ccc(OCCSC(=S)N4CCN(C)CC4)cc3)ncc2F)c1 |
| InChI | InChI=1S/C27H30FN7O2S2/c1-3-24(36)30-20-5-4-6-21(17-20)31-25-23(28)18-29-26(33-25)32-19-7-9-22(10-8-19)37-15-16-39-27(38)35-13-11-34(2)12-14-35/h3-10,17-18H,1,11-16H2,2H3,(H,30,36)(H2,29,31,32,33) |
| InChIKey | XWPVCUNSIFCTKU-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.72 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|