C28H33FN6O2 — CID 129028244
N-[3-[[2-[4-[[1-(2-aminoethyl)cyclohexyl]methoxy]anilino]-5-fluoropyrimidin-4-yl]amino]phenyl]prop-2-enamide (PubChem CID 129028244) has the molecular formula C28H33FN6O2 and a molecular weight of 504.61 g/mol. Its IUPAC name is N-[3-[[2-[4-[[1-(2-aminoethyl)cyclohexyl]methoxy]anilino]-5-fluoropyrimidin-4-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[2-[4-[[1-(2-aminoethyl)cyclohexyl]methoxy]anilino]-5-fluoropyrimidin-4-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 129028244 |
| Molecular Formula | C28H33FN6O2 |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | N-[3-[[2-[4-[[1-(2-aminoethyl)cyclohexyl]methoxy]anilino]-5-fluoropyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Nc2nc(Nc3ccc(OCC4(CCN)CCCCC4)cc3)ncc2F)c1 |
| InChI | InChI=1S/C28H33FN6O2/c1-2-25(36)32-21-7-6-8-22(17-21)33-26-24(29)18-31-27(35-26)34-20-9-11-23(12-10-20)37-19-28(15-16-30)13-4-3-5-14-28/h2,6-12,17-18H,1,3-5,13-16,19,30H2,(H,32,36)(H2,31,33,34,35) |
| InChIKey | UCDSYNQEXMAXRC-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|