C28H30FN7O2 — CID 159555595
N-[3-[[2-[4-(1-bicyclo[2.2.2]octanylmethoxy)anilino]-5-fluoropyrimidin-4-yl]amino]phenyl]prop-2-enamide;molecular nitrogen (PubChem CID 159555595) has the molecular formula C28H30FN7O2 and a molecular weight of 515.59 g/mol. Its IUPAC name is N-[3-[[2-[4-(1-bicyclo[2.2.2]octanylmethoxy)anilino]-5-fluoropyrimidin-4-yl]amino]phenyl]prop-2-enamide;molecular nitrogen.
| Compound Name | N-[3-[[2-[4-(1-bicyclo[2.2.2]octanylmethoxy)anilino]-5-fluoropyrimidin-4-yl]amino]phenyl]prop-2-enamide;molecular nitrogen |
|---|---|
| PubChem CID | 159555595 |
| Molecular Formula | C28H30FN7O2 |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | N-[3-[[2-[4-(1-bicyclo[2.2.2]octanylmethoxy)anilino]-5-fluoropyrimidin-4-yl]amino]phenyl]prop-2-enamide;molecular nitrogen |
| SMILES | C=CC(=O)Nc1cccc(Nc2nc(Nc3ccc(OCC45CCC(CC4)CC5)cc3)ncc2F)c1.N#N |
| InChI | InChI=1S/C28H30FN5O2.N2/c1-2-25(35)31-21-4-3-5-22(16-21)32-26-24(29)17-30-27(34-26)33-20-6-8-23(9-7-20)36-18-28-13-10-19(11-14-28)12-15-28;1-2/h2-9,16-17,19H,1,10-15,18H2,(H,31,35)(H2,30,32,33,34); |
| InChIKey | MFYHJAJCWFTADP-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 135.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|