C23H21ClFN5O3 — CID 59174407
N-[3-[[2-[4-chloro-3-[(3R)-oxolan-3-yl]oxyanilino]-5-fluoropyrimidin-4-yl]amino]phenyl]prop-2-enamide (PubChem CID 59174407) has the molecular formula C23H21ClFN5O3 and a molecular weight of 469.90 g/mol. Its IUPAC name is N-[3-[[2-[4-chloro-3-[(3R)-oxolan-3-yl]oxyanilino]-5-fluoropyrimidin-4-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[2-[4-chloro-3-[(3R)-oxolan-3-yl]oxyanilino]-5-fluoropyrimidin-4-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 59174407 |
| Molecular Formula | C23H21ClFN5O3 |
| Molecular Weight | 469.90 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | N-[3-[[2-[4-chloro-3-[(3R)-oxolan-3-yl]oxyanilino]-5-fluoropyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Nc2nc(Nc3ccc(Cl)c(O[C@@H]4CCOC4)c3)ncc2F)c1 |
| InChI | InChI=1S/C23H21ClFN5O3/c1-2-21(31)27-14-4-3-5-15(10-14)28-22-19(25)12-26-23(30-22)29-16-6-7-18(24)20(11-16)33-17-8-9-32-13-17/h2-7,10-12,17H,1,8-9,13H2,(H,27,31)(H2,26,28,29,30)/t17-/m1/s1 |
| InChIKey | ITCAPRQOBQUQMI-QGZVFWFLSA-N |
| XLogP | 5.05 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.90 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|