C28H31FN6O2 — CID 59174819
N-[3-[[2-[4-[(4-amino-1-bicyclo[2.2.2]octanyl)methoxy]anilino]-5-fluoropyrimidin-4-yl]amino]phenyl]prop-2-enamide (PubChem CID 59174819) has the molecular formula C28H31FN6O2 and a molecular weight of 502.59 g/mol. Its IUPAC name is N-[3-[[2-[4-[(4-amino-1-bicyclo[2.2.2]octanyl)methoxy]anilino]-5-fluoropyrimidin-4-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[2-[4-[(4-amino-1-bicyclo[2.2.2]octanyl)methoxy]anilino]-5-fluoropyrimidin-4-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 59174819 |
| Molecular Formula | C28H31FN6O2 |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | N-[3-[[2-[4-[(4-amino-1-bicyclo[2.2.2]octanyl)methoxy]anilino]-5-fluoropyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Nc2nc(Nc3ccc(OCC45CCC(N)(CC4)CC5)cc3)ncc2F)c1 |
| InChI | InChI=1S/C28H31FN6O2/c1-2-24(36)32-20-4-3-5-21(16-20)33-25-23(29)17-31-26(35-25)34-19-6-8-22(9-7-19)37-18-27-10-13-28(30,14-11-27)15-12-27/h2-9,16-17H,1,10-15,18,30H2,(H,32,36)(H2,31,33,34,35) |
| InChIKey | RXLKMCMJWVQABW-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|