C27H31FN6O2 — CID 163793982
N-[3-[[5-fluoro-2-[4-[(1-methylpiperidin-4-yl)methoxymethyl]anilino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide (PubChem CID 163793982) has the molecular formula C27H31FN6O2 and a molecular weight of 490.58 g/mol. Its IUPAC name is N-[3-[[5-fluoro-2-[4-[(1-methylpiperidin-4-yl)methoxymethyl]anilino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[5-fluoro-2-[4-[(1-methylpiperidin-4-yl)methoxymethyl]anilino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 163793982 |
| Molecular Formula | C27H31FN6O2 |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | N-[3-[[5-fluoro-2-[4-[(1-methylpiperidin-4-yl)methoxymethyl]anilino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Nc2nc(Nc3ccc(COCC4CCN(C)CC4)cc3)ncc2F)c1 |
| InChI | InChI=1S/C27H31FN6O2/c1-3-25(35)30-22-5-4-6-23(15-22)31-26-24(28)16-29-27(33-26)32-21-9-7-19(8-10-21)17-36-18-20-11-13-34(2)14-12-20/h3-10,15-16,20H,1,11-14,17-18H2,2H3,(H,30,35)(H2,29,31,32,33) |
| InChIKey | MZEJTNZSWKXSNQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|