C26H30FN7O — CID 123286315
N-[3-[[5-fluoro-2-[4-[(1-propylpyrrolidin-3-yl)amino]anilino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide (PubChem CID 123286315) has the molecular formula C26H30FN7O and a molecular weight of 475.57 g/mol. Its IUPAC name is N-[3-[[5-fluoro-2-[4-[(1-propylpyrrolidin-3-yl)amino]anilino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[5-fluoro-2-[4-[(1-propylpyrrolidin-3-yl)amino]anilino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 123286315 |
| Molecular Formula | C26H30FN7O |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | N-[3-[[5-fluoro-2-[4-[(1-propylpyrrolidin-3-yl)amino]anilino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Nc2nc(Nc3ccc(NC4CCN(CCC)C4)cc3)ncc2F)c1 |
| InChI | InChI=1S/C26H30FN7O/c1-3-13-34-14-12-22(17-34)29-18-8-10-19(11-9-18)32-26-28-16-23(27)25(33-26)31-21-7-5-6-20(15-21)30-24(35)4-2/h4-11,15-16,22,29H,2-3,12-14,17H2,1H3,(H,30,35)(H2,28,31,32,33) |
| InChIKey | OWKKLOXQAHCDGK-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 94.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|