C23H27FN6O — CID 59174590
4-N-(3-aminophenyl)-5-fluoro-2-N-[4-[(1-methylpiperidin-4-yl)methoxy]phenyl]pyrimidine-2,4-diamine (PubChem CID 59174590) has the molecular formula C23H27FN6O and a molecular weight of 422.51 g/mol. Its IUPAC name is 4-N-(3-aminophenyl)-5-fluoro-2-N-[4-[(1-methylpiperidin-4-yl)methoxy]phenyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-aminophenyl)-5-fluoro-2-N-[4-[(1-methylpiperidin-4-yl)methoxy]phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 59174590 |
| Molecular Formula | C23H27FN6O |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 4-N-(3-aminophenyl)-5-fluoro-2-N-[4-[(1-methylpiperidin-4-yl)methoxy]phenyl]pyrimidine-2,4-diamine |
| SMILES | CN1CCC(COc2ccc(Nc3ncc(F)c(Nc4cccc(N)c4)n3)cc2)CC1 |
| InChI | InChI=1S/C23H27FN6O/c1-30-11-9-16(10-12-30)15-31-20-7-5-18(6-8-20)28-23-26-14-21(24)22(29-23)27-19-4-2-3-17(25)13-19/h2-8,13-14,16H,9-12,15,25H2,1H3,(H2,26,27,28,29) |
| InChIKey | BIGVIJJRYUVYLD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|