C16H15FN6O2S — CID 59174760
3-[[4-(3-aminoanilino)-5-fluoropyrimidin-2-yl]amino]benzenesulfonamide (PubChem CID 59174760) has the molecular formula C16H15FN6O2S and a molecular weight of 374.40 g/mol. Its IUPAC name is 3-[[4-(3-aminoanilino)-5-fluoropyrimidin-2-yl]amino]benzenesulfonamide.
| Compound Name | 3-[[4-(3-aminoanilino)-5-fluoropyrimidin-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 59174760 |
| Molecular Formula | C16H15FN6O2S |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 3-[[4-(3-aminoanilino)-5-fluoropyrimidin-2-yl]amino]benzenesulfonamide |
| SMILES | Nc1cccc(Nc2nc(Nc3cccc(S(N)(=O)=O)c3)ncc2F)c1 |
| InChI | InChI=1S/C16H15FN6O2S/c17-14-9-20-16(22-12-5-2-6-13(8-12)26(19,24)25)23-15(14)21-11-4-1-3-10(18)7-11/h1-9H,18H2,(H2,19,24,25)(H2,20,21,22,23) |
| InChIKey | NMUVXSGPXKSSAO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|