C18H18FN7O3S — CID 68873174
[3-[[5-fluoro-2-(4-sulfamoylanilino)pyrimidin-4-yl]amino]phenyl]methylurea (PubChem CID 68873174) has the molecular formula C18H18FN7O3S and a molecular weight of 431.45 g/mol. Its IUPAC name is [3-[[5-fluoro-2-(4-sulfamoylanilino)pyrimidin-4-yl]amino]phenyl]methylurea.
| Compound Name | [3-[[5-fluoro-2-(4-sulfamoylanilino)pyrimidin-4-yl]amino]phenyl]methylurea |
|---|---|
| PubChem CID | 68873174 |
| Molecular Formula | C18H18FN7O3S |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | [3-[[5-fluoro-2-(4-sulfamoylanilino)pyrimidin-4-yl]amino]phenyl]methylurea |
| SMILES | NC(=O)NCc1cccc(Nc2nc(Nc3ccc(S(N)(=O)=O)cc3)ncc2F)c1 |
| InChI | InChI=1S/C18H18FN7O3S/c19-15-10-23-18(25-12-4-6-14(7-5-12)30(21,28)29)26-16(15)24-13-3-1-2-11(8-13)9-22-17(20)27/h1-8,10H,9H2,(H3,20,22,27)(H2,21,28,29)(H2,23,24,25,26) |
| InChIKey | WJSIJGIUPNCWQI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 165.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |