C19H19FN6O4S — CID 15605078
2-[4-[[5-fluoro-2-(3-sulfamoylanilino)pyrimidin-4-yl]amino]-2-methylphenoxy]acetamide (PubChem CID 15605078) has the molecular formula C19H19FN6O4S and a molecular weight of 446.46 g/mol. Its IUPAC name is 2-[4-[[5-fluoro-2-(3-sulfamoylanilino)pyrimidin-4-yl]amino]-2-methylphenoxy]acetamide.
| Compound Name | 2-[4-[[5-fluoro-2-(3-sulfamoylanilino)pyrimidin-4-yl]amino]-2-methylphenoxy]acetamide |
|---|---|
| PubChem CID | 15605078 |
| Molecular Formula | C19H19FN6O4S |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 2-[4-[[5-fluoro-2-(3-sulfamoylanilino)pyrimidin-4-yl]amino]-2-methylphenoxy]acetamide |
| SMILES | Cc1cc(Nc2nc(Nc3cccc(S(N)(=O)=O)c3)ncc2F)ccc1OCC(N)=O |
| InChI | InChI=1S/C19H19FN6O4S/c1-11-7-13(5-6-16(11)30-10-17(21)27)24-18-15(20)9-23-19(26-18)25-12-3-2-4-14(8-12)31(22,28)29/h2-9H,10H2,1H3,(H2,21,27)(H2,22,28,29)(H2,23,24,25,26) |
| InChIKey | XKEIAUQAVHFLJL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 162.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |