C16H14FN5O4S2 — CID 25123992
methyl 5-[[5-fluoro-2-(3-sulfamoylanilino)pyrimidin-4-yl]amino]thiophene-2-carboxylate (PubChem CID 25123992) has the molecular formula C16H14FN5O4S2 and a molecular weight of 423.45 g/mol. Its IUPAC name is methyl 5-[[5-fluoro-2-(3-sulfamoylanilino)pyrimidin-4-yl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 5-[[5-fluoro-2-(3-sulfamoylanilino)pyrimidin-4-yl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 25123992 |
| Molecular Formula | C16H14FN5O4S2 |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | methyl 5-[[5-fluoro-2-(3-sulfamoylanilino)pyrimidin-4-yl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(Nc2nc(Nc3cccc(S(N)(=O)=O)c3)ncc2F)s1 |
| InChI | InChI=1S/C16H14FN5O4S2/c1-26-15(23)12-5-6-13(27-12)21-14-11(17)8-19-16(22-14)20-9-3-2-4-10(7-9)28(18,24)25/h2-8H,1H3,(H2,18,24,25)(H2,19,20,21,22) |
| InChIKey | VAWRULOLYNMUKJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |