C21H22FN7O3S — CID 25127639
3-[[5-fluoro-4-[[1-(3-methoxypropyl)indazol-5-yl]amino]pyrimidin-2-yl]amino]benzenesulfonamide (PubChem CID 25127639) has the molecular formula C21H22FN7O3S and a molecular weight of 471.52 g/mol. Its IUPAC name is 3-[[5-fluoro-4-[[1-(3-methoxypropyl)indazol-5-yl]amino]pyrimidin-2-yl]amino]benzenesulfonamide.
| Compound Name | 3-[[5-fluoro-4-[[1-(3-methoxypropyl)indazol-5-yl]amino]pyrimidin-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 25127639 |
| Molecular Formula | C21H22FN7O3S |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 3-[[5-fluoro-4-[[1-(3-methoxypropyl)indazol-5-yl]amino]pyrimidin-2-yl]amino]benzenesulfonamide |
| SMILES | COCCCn1ncc2cc(Nc3nc(Nc4cccc(S(N)(=O)=O)c4)ncc3F)ccc21 |
| InChI | InChI=1S/C21H22FN7O3S/c1-32-9-3-8-29-19-7-6-16(10-14(19)12-25-29)26-20-18(22)13-24-21(28-20)27-15-4-2-5-17(11-15)33(23,30)31/h2,4-7,10-13H,3,8-9H2,1H3,(H2,23,30,31)(H2,24,26,27,28) |
| InChIKey | MJRZUCYARBFJEE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 137.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|