C21H21FN6O4S — CID 68872226
2-[4-[[5-fluoro-2-(4-sulfamoylanilino)pyrimidin-4-yl]amino]phenoxy]-N-prop-2-enylacetamide (PubChem CID 68872226) has the molecular formula C21H21FN6O4S and a molecular weight of 472.50 g/mol. Its IUPAC name is 2-[4-[[5-fluoro-2-(4-sulfamoylanilino)pyrimidin-4-yl]amino]phenoxy]-N-prop-2-enylacetamide.
| Compound Name | 2-[4-[[5-fluoro-2-(4-sulfamoylanilino)pyrimidin-4-yl]amino]phenoxy]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 68872226 |
| Molecular Formula | C21H21FN6O4S |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 2-[4-[[5-fluoro-2-(4-sulfamoylanilino)pyrimidin-4-yl]amino]phenoxy]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)COc1ccc(Nc2nc(Nc3ccc(S(N)(=O)=O)cc3)ncc2F)cc1 |
| InChI | InChI=1S/C21H21FN6O4S/c1-2-11-24-19(29)13-32-16-7-3-14(4-8-16)26-20-18(22)12-25-21(28-20)27-15-5-9-17(10-6-15)33(23,30)31/h2-10,12H,1,11,13H2,(H,24,29)(H2,23,30,31)(H2,25,26,27,28) |
| InChIKey | OZLCMNGNLMPONC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 148.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|