C28H26FN7O2S2 — CID 155511219
2-[4-[[5-fluoro-4-[3-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]phenoxy]ethyl N-(pyridin-2-ylmethyl)carbamodithioate (PubChem CID 155511219) has the molecular formula C28H26FN7O2S2 and a molecular weight of 575.70 g/mol. Its IUPAC name is 2-[4-[[5-fluoro-4-[3-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]phenoxy]ethyl N-(pyridin-2-ylmethyl)carbamodithioate.
| Compound Name | 2-[4-[[5-fluoro-4-[3-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]phenoxy]ethyl N-(pyridin-2-ylmethyl)carbamodithioate |
|---|---|
| PubChem CID | 155511219 |
| Molecular Formula | C28H26FN7O2S2 |
| Molecular Weight | 575.70 g/mol |
| Exact Mass | 575.16 |
| IUPAC Name | 2-[4-[[5-fluoro-4-[3-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]phenoxy]ethyl N-(pyridin-2-ylmethyl)carbamodithioate |
| SMILES | C=CC(=O)Nc1cccc(Nc2nc(Nc3ccc(OCCSC(=S)NCc4ccccn4)cc3)ncc2F)c1 |
| InChI | InChI=1S/C28H26FN7O2S2/c1-2-25(37)33-20-7-5-8-21(16-20)34-26-24(29)18-31-27(36-26)35-19-9-11-23(12-10-19)38-14-15-40-28(39)32-17-22-6-3-4-13-30-22/h2-13,16,18H,1,14-15,17H2,(H,32,39)(H,33,37)(H2,31,34,35,36) |
| InChIKey | OSTUJIPJSCUQGO-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.70 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_carbam_A(1)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|