C25H28F2N6O2 — CID 139565426
N-[3-[[5-(1,1-difluoropentyl)-2-[(6-methoxy-3-pyridinyl)amino]pyrimidin-4-yl]-methylamino]phenyl]prop-2-enamide (PubChem CID 139565426) has the molecular formula C25H28F2N6O2 and a molecular weight of 482.54 g/mol. Its IUPAC name is N-[3-[[5-(1,1-difluoropentyl)-2-[(6-methoxy-3-pyridinyl)amino]pyrimidin-4-yl]-methylamino]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[5-(1,1-difluoropentyl)-2-[(6-methoxy-3-pyridinyl)amino]pyrimidin-4-yl]-methylamino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 139565426 |
| Molecular Formula | C25H28F2N6O2 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | N-[3-[[5-(1,1-difluoropentyl)-2-[(6-methoxy-3-pyridinyl)amino]pyrimidin-4-yl]-methylamino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(N(C)c2nc(Nc3ccc(OC)nc3)ncc2C(F)(F)CCCC)c1 |
| InChI | InChI=1S/C25H28F2N6O2/c1-5-7-13-25(26,27)20-16-29-24(31-18-11-12-22(35-4)28-15-18)32-23(20)33(3)19-10-8-9-17(14-19)30-21(34)6-2/h6,8-12,14-16H,2,5,7,13H2,1,3-4H3,(H,30,34)(H,29,31,32) |
| InChIKey | SCBSIIRETWZBKJ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|