C27H30F3N7O2 — CID 142373603
N-[3-[[2-[4-(4-ethylpiperazin-1-yl)-3-methoxyanilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenyl]prop-2-enamide (PubChem CID 142373603) has the molecular formula C27H30F3N7O2 and a molecular weight of 541.58 g/mol. Its IUPAC name is N-[3-[[2-[4-(4-ethylpiperazin-1-yl)-3-methoxyanilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[2-[4-(4-ethylpiperazin-1-yl)-3-methoxyanilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 142373603 |
| Molecular Formula | C27H30F3N7O2 |
| Molecular Weight | 541.58 g/mol |
| Exact Mass | 541.24 |
| IUPAC Name | N-[3-[[2-[4-(4-ethylpiperazin-1-yl)-3-methoxyanilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Nc2nc(Nc3ccc(N4CCN(CC)CC4)c(OC)c3)ncc2C(F)(F)F)c1 |
| InChI | InChI=1S/C27H30F3N7O2/c1-4-24(38)32-18-7-6-8-19(15-18)33-25-21(27(28,29)30)17-31-26(35-25)34-20-9-10-22(23(16-20)39-3)37-13-11-36(5-2)12-14-37/h4,6-10,15-17H,1,5,11-14H2,2-3H3,(H,32,38)(H2,31,33,34,35) |
| InChIKey | XBVDJJWZEVYBMP-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.58 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|