C23H20F3N5O4 — CID 134342296
N-[3-[[2-(2-formyl-3,4-dimethoxyanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenyl]prop-2-enamide (PubChem CID 134342296) has the molecular formula C23H20F3N5O4 and a molecular weight of 487.44 g/mol. Its IUPAC name is N-[3-[[2-(2-formyl-3,4-dimethoxyanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[2-(2-formyl-3,4-dimethoxyanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 134342296 |
| Molecular Formula | C23H20F3N5O4 |
| Molecular Weight | 487.44 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | N-[3-[[2-(2-formyl-3,4-dimethoxyanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Nc2nc(Nc3ccc(OC)c(OC)c3C=O)ncc2C(F)(F)F)c1 |
| InChI | InChI=1S/C23H20F3N5O4/c1-4-19(33)28-13-6-5-7-14(10-13)29-21-16(23(24,25)26)11-27-22(31-21)30-17-8-9-18(34-2)20(35-3)15(17)12-32/h4-12H,1H2,2-3H3,(H,28,33)(H2,27,29,30,31) |
| InChIKey | BWYBUVPBTVAZPK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.44 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|