C30H36F3N7O2 — CID 172846448
N-[3-[[2-[2-methoxy-4-(4-pentylpiperazin-1-yl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenyl]prop-2-enamide (PubChem CID 172846448) has the molecular formula C30H36F3N7O2 and a molecular weight of 583.66 g/mol. Its IUPAC name is N-[3-[[2-[2-methoxy-4-(4-pentylpiperazin-1-yl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[2-[2-methoxy-4-(4-pentylpiperazin-1-yl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 172846448 |
| Molecular Formula | C30H36F3N7O2 |
| Molecular Weight | 583.66 g/mol |
| Exact Mass | 583.29 |
| IUPAC Name | N-[3-[[2-[2-methoxy-4-(4-pentylpiperazin-1-yl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Nc2nc(Nc3ccc(N4CCN(CCCCC)CC4)cc3OC)ncc2C(F)(F)F)c1 |
| InChI | InChI=1S/C30H36F3N7O2/c1-4-6-7-13-39-14-16-40(17-15-39)23-11-12-25(26(19-23)42-3)37-29-34-20-24(30(31,32)33)28(38-29)36-22-10-8-9-21(18-22)35-27(41)5-2/h5,8-12,18-20H,2,4,6-7,13-17H2,1,3H3,(H,35,41)(H2,34,36,37,38) |
| InChIKey | XMIILJCOOCIBJU-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.66 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|