C29H30F3N7O3 — CID 118465000
N-[3-[[2-[4-(5-acetyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)-2-methoxyanilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenyl]prop-2-enamide (PubChem CID 118465000) has the molecular formula C29H30F3N7O3 and a molecular weight of 581.60 g/mol. Its IUPAC name is N-[3-[[2-[4-(5-acetyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)-2-methoxyanilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[2-[4-(5-acetyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)-2-methoxyanilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118465000 |
| Molecular Formula | C29H30F3N7O3 |
| Molecular Weight | 581.60 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | N-[3-[[2-[4-(5-acetyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)-2-methoxyanilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Nc2nc(Nc3ccc(N4CC5CN(C(C)=O)CC5C4)cc3OC)ncc2C(F)(F)F)c1 |
| InChI | InChI=1S/C29H30F3N7O3/c1-4-26(41)34-20-6-5-7-21(10-20)35-27-23(29(30,31)32)12-33-28(37-27)36-24-9-8-22(11-25(24)42-3)39-15-18-13-38(17(2)40)14-19(18)16-39/h4-12,18-19H,1,13-16H2,2-3H3,(H,34,41)(H2,33,35,36,37) |
| InChIKey | WWDHGKKYFXZYKK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.60 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|