C29H35N7O4 — CID 145356547
[(1S)-1-[2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-4-[3-(prop-2-enoylamino)anilino]pyrimidin-5-yl]propyl] formate (PubChem CID 145356547) has the molecular formula C29H35N7O4 and a molecular weight of 545.64 g/mol. Its IUPAC name is [(1S)-1-[2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-4-[3-(prop-2-enoylamino)anilino]pyrimidin-5-yl]propyl] formate.
| Compound Name | [(1S)-1-[2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-4-[3-(prop-2-enoylamino)anilino]pyrimidin-5-yl]propyl] formate |
|---|---|
| PubChem CID | 145356547 |
| Molecular Formula | C29H35N7O4 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | [(1S)-1-[2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-4-[3-(prop-2-enoylamino)anilino]pyrimidin-5-yl]propyl] formate |
| SMILES | C=CC(=O)Nc1cccc(Nc2nc(Nc3ccc(N4CCN(C)CC4)cc3OC)ncc2[C@H](CC)OC=O)c1 |
| InChI | InChI=1S/C29H35N7O4/c1-5-25(40-19-37)23-18-30-29(34-28(23)32-21-9-7-8-20(16-21)31-27(38)6-2)33-24-11-10-22(17-26(24)39-4)36-14-12-35(3)13-15-36/h6-11,16-19,25H,2,5,12-15H2,1,3-4H3,(H,31,38)(H2,30,32,33,34)/t25-/m0/s1 |
| InChIKey | SEZJQVPSXQEBDS-VWLOTQADSA-N |
| XLogP | 4.47 |
| TPSA | 120.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|