C17H19F3N4O — CID 145135698
ethane;N-[3-[[2-methyl-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenyl]prop-2-enamide (PubChem CID 145135698) has the molecular formula C17H19F3N4O and a molecular weight of 352.36 g/mol. Its IUPAC name is ethane;N-[3-[[2-methyl-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenyl]prop-2-enamide.
| Compound Name | ethane;N-[3-[[2-methyl-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 145135698 |
| Molecular Formula | C17H19F3N4O |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | ethane;N-[3-[[2-methyl-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Nc2nc(C)ncc2C(F)(F)F)c1.CC |
| InChI | InChI=1S/C15H13F3N4O.C2H6/c1-3-13(23)21-10-5-4-6-11(7-10)22-14-12(15(16,17)18)8-19-9(2)20-14;1-2/h3-8H,1H2,2H3,(H,21,23)(H,19,20,22);1-2H3 |
| InChIKey | YEQIPMFBJQEIGF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|