C16H14F3N3O — CID 144945731
N-[3-[[2-methyl-5-(trifluoromethyl)-4-pyridinyl]amino]phenyl]prop-2-enamide (PubChem CID 144945731) has the molecular formula C16H14F3N3O and a molecular weight of 321.30 g/mol. Its IUPAC name is N-[3-[[2-methyl-5-(trifluoromethyl)-4-pyridinyl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[2-methyl-5-(trifluoromethyl)-4-pyridinyl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 144945731 |
| Molecular Formula | C16H14F3N3O |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | N-[3-[[2-methyl-5-(trifluoromethyl)-4-pyridinyl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Nc2cc(C)ncc2C(F)(F)F)c1 |
| InChI | InChI=1S/C16H14F3N3O/c1-3-15(23)22-12-6-4-5-11(8-12)21-14-7-10(2)20-9-13(14)16(17,18)19/h3-9H,1H2,2H3,(H,20,21)(H,22,23) |
| InChIKey | PATHNLOOUQLNES-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|