C25H27F3N8O2S2 — CID 145279170
CID 145279170 (PubChem CID 145279170) has the molecular formula C25H27F3N8O2S2 and a molecular weight of 592.67 g/mol.
| Compound Name | CID 145279170 |
|---|---|
| PubChem CID | 145279170 |
| Molecular Formula | C25H27F3N8O2S2 |
| Molecular Weight | 592.67 g/mol |
| Exact Mass | 592.17 |
| IUPAC Name | — |
| SMILES | C=CC(=O)Nc1cccc(Nc2nc(Nc3ccc(N4CCN(C(C)=O)CC4)nc3)ncc2C(F)(F)F)c1.SS |
| InChI | InChI=1S/C25H25F3N8O2.H2S2/c1-3-22(38)31-17-5-4-6-18(13-17)32-23-20(25(26,27)28)15-30-24(34-23)33-19-7-8-21(29-14-19)36-11-9-35(10-12-36)16(2)37;1-2/h3-8,13-15H,1,9-12H2,2H3,(H,31,38)(H2,30,32,33,34);1-2H |
| InChIKey | UHKXHZQMDILYBC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.67 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|