C21H18F3N5O2 — CID 89432436
1-[3-[[2-[(6-methoxy-3-pyridinyl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenyl]but-3-en-2-one (PubChem CID 89432436) has the molecular formula C21H18F3N5O2 and a molecular weight of 429.40 g/mol. Its IUPAC name is 1-[3-[[2-[(6-methoxy-3-pyridinyl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenyl]but-3-en-2-one.
| Compound Name | 1-[3-[[2-[(6-methoxy-3-pyridinyl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 89432436 |
| Molecular Formula | C21H18F3N5O2 |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 1-[3-[[2-[(6-methoxy-3-pyridinyl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cccc(Nc2nc(Nc3ccc(OC)nc3)ncc2C(F)(F)F)c1 |
| InChI | InChI=1S/C21H18F3N5O2/c1-3-16(30)10-13-5-4-6-14(9-13)27-19-17(21(22,23)24)12-26-20(29-19)28-15-7-8-18(31-2)25-11-15/h3-9,11-12H,1,10H2,2H3,(H2,26,27,28,29) |
| InChIKey | YECWUMYCXJVIBR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|