C23H19N7O3 — CID 59174623
N-[3-[[5-cyano-2-[(6-methoxy-3-pyridinyl)amino]pyrimidin-4-yl]-prop-2-enoylamino]phenyl]prop-2-enamide (PubChem CID 59174623) has the molecular formula C23H19N7O3 and a molecular weight of 441.45 g/mol. Its IUPAC name is N-[3-[[5-cyano-2-[(6-methoxy-3-pyridinyl)amino]pyrimidin-4-yl]-prop-2-enoylamino]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[5-cyano-2-[(6-methoxy-3-pyridinyl)amino]pyrimidin-4-yl]-prop-2-enoylamino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 59174623 |
| Molecular Formula | C23H19N7O3 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | N-[3-[[5-cyano-2-[(6-methoxy-3-pyridinyl)amino]pyrimidin-4-yl]-prop-2-enoylamino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(N(C(=O)C=C)c2nc(Nc3ccc(OC)nc3)ncc2C#N)c1 |
| InChI | InChI=1S/C23H19N7O3/c1-4-19(31)27-16-7-6-8-18(11-16)30(21(32)5-2)22-15(12-24)13-26-23(29-22)28-17-9-10-20(33-3)25-14-17/h4-11,13-14H,1-2H2,3H3,(H,27,31)(H,26,28,29) |
| InChIKey | JQZJSVYLROQXIC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 133.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|