C22H22N4O4 — CID 67966797
N-[3-[2-(2,4-dimethoxyanilino)-5-methylpyrimidin-4-yl]oxyphenyl]prop-2-enamide (PubChem CID 67966797) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is N-[3-[2-(2,4-dimethoxyanilino)-5-methylpyrimidin-4-yl]oxyphenyl]prop-2-enamide.
| Compound Name | N-[3-[2-(2,4-dimethoxyanilino)-5-methylpyrimidin-4-yl]oxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 67966797 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | N-[3-[2-(2,4-dimethoxyanilino)-5-methylpyrimidin-4-yl]oxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(OC)cc3OC)ncc2C)c1 |
| InChI | InChI=1S/C22H22N4O4/c1-5-20(27)24-15-7-6-8-17(11-15)30-21-14(2)13-23-22(26-21)25-18-10-9-16(28-3)12-19(18)29-4/h5-13H,1H2,2-4H3,(H,24,27)(H,23,25,26) |
| InChIKey | XDLRXDFOEWVKHI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|